ChemNet > CAS > 2049-73-2 1,3-Diethoxybenzene
2049-73-2 1,3-Diethoxybenzene
Nazwa produktu: |
1,3-Diethoxybenzene |
Synonimy |
1,3-Diethoxybenzene, (Resorcinol diethyl ether); Resorsinol diethyl ether; Resorcinol diethyl ether |
MF |
C10H14O2 |
Masie cząsteczkowej |
166.217 |
InChI |
InChI=1/C10H14O2/c1-3-11-9-6-5-7-10(8-9)12-4-2/h5-8H,3-4H2,1-2H3 |
Nr CAS |
2049-73-2 |
EINECS |
218-071-3 |
Struktury molekularnej |
|
Gęstość |
0.975g/cm3 |
Temperatura topnienia |
10-236℃ |
Temperatura wrzenia |
238.5°C at 760 mmHg |
Współczynnik załamania |
1.485 |
Temperatura zapłonu |
87.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|