ChemNet > CAS > 205526-34-7 (R)-N-FMOC-4-Cyanophenylalanine
205526-34-7 (R)-N-FMOC-4-Cyanophenylalanine
Nazwa produktu: |
(R)-N-FMOC-4-Cyanophenylalanine |
Synonimy |
Fmoc-D-4-Cyanophenylalanine; Fmoc-4-Cyano-D-phenylalanine; Fmoc-D-Phe(4-CN)-OH |
MF |
C25H19N2O4 |
Masie cząsteczkowej |
411.4299 |
InChI |
InChI=1/C25H20N2O4/c26-14-17-11-9-16(10-12-17)13-23(24(28)29)27-25(30)31-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22-23H,13,15H2,(H,27,30)(H,28,29)/p-1/t23-/m1/s1 |
Nr CAS |
205526-34-7 |
Struktury molekularnej |
|
Temperatura topnienia |
188.1℃ |
Temperatura wrzenia |
678.7°C at 760 mmHg |
Temperatura zapłonu |
364.3°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|