ChemNet > CAS > 207974-19-4 2,3-difluoromandelic acid
207974-19-4 2,3-difluoromandelic acid
Nazwa produktu: |
2,3-difluoromandelic acid |
Synonimy |
alpha-Hydroxy-2,3-difluorophenylacetic acid; (2,3-difluorophenyl)(hydroxy)acetic acid |
MF |
C8H6F2O3 |
Masie cząsteczkowej |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
Nr CAS |
207974-19-4 |
Struktury molekularnej |
|
Gęstość |
1.522g/cm3 |
Temperatura wrzenia |
313.3°C at 760 mmHg |
Współczynnik załamania |
1.542 |
Temperatura zapłonu |
143.3°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|