ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
Nazwa produktu: |
3-Nitrobiphenyl |
Synonimy |
3-Nitrodiphenyl |
MF |
C12H9NO2 |
Masie cząsteczkowej |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
Nr CAS |
2113-58-8 |
EINECS |
218-305-4 |
Struktury molekularnej |
|
Gęstość |
1.196g/cm3 |
Temperatura topnienia |
56-60℃ |
Temperatura wrzenia |
339°C at 760 mmHg |
Współczynnik załamania |
1.605 |
Temperatura zapłonu |
161.4°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|