ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
Nazwa produktu: |
3-(trifluoromethyl)phenoxyacetonitrile |
Synonimy |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
MF |
C8H7FO3 |
Masie cząsteczkowej |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
Nr CAS |
2145-31-5 |
Struktury molekularnej |
|
Gęstość |
1.309g/cm3 |
Temperatura wrzenia |
268.9°C at 760 mmHg |
Współczynnik załamania |
1.526 |
Temperatura zapłonu |
116.4°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|