ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
Nazwa produktu: |
3-Cyclohexene-1,1-dimethanol |
Synonimy |
4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
MF |
C8H14O2 |
Masie cząsteczkowej |
142.1956 |
InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
Nr CAS |
2160-94-3 |
EINECS |
218-481-2 |
Struktury molekularnej |
|
Gęstość |
1.05g/cm3 |
Temperatura topnienia |
88-92℃ |
Temperatura wrzenia |
231.2°C at 760 mmHg |
Współczynnik załamania |
1.497 |
Temperatura zapłonu |
105°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|