ChemNet > CAS > 23351-07-7 1-(4-Cyanophenyl)-pyrrole
23351-07-7 1-(4-Cyanophenyl)-pyrrole
Nazwa produktu: |
1-(4-Cyanophenyl)-pyrrole |
Synonimy |
4-(1H-Pyrrol-1-yl)benzonitrile |
MF |
C11H8N2 |
Masie cząsteczkowej |
168.1946 |
InChI |
InChI=1/C11H8N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H |
Nr CAS |
23351-07-7 |
Struktury molekularnej |
|
Gęstość |
1.05g/cm3 |
Temperatura wrzenia |
312.8°C at 760 mmHg |
Współczynnik załamania |
1.589 |
Temperatura zapłonu |
143°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|