ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
Nazwa produktu: |
3,4-difluoropropiophenone |
Synonimy |
3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
MF |
C9H8F2O |
Masie cząsteczkowej |
170.156 |
InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
Nr CAS |
23384-72-7 |
EINECS |
245-627-2 |
Struktury molekularnej |
|
Gęstość |
1.166g/cm3 |
Temperatura wrzenia |
225°C at 760 mmHg |
Współczynnik załamania |
1.472 |
Temperatura zapłonu |
84.8°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|