ChemNet > CAS > 2351-37-3 Biphenyldicarbonylchloride
2351-37-3 Biphenyldicarbonylchloride
Nazwa produktu: |
Biphenyldicarbonylchloride |
Synonimy |
4,4-Biphenyldicarbonyl chloride; 4,4'-Biphenyldicarbonyl Chloride |
MF |
C14H8Cl2O2 |
Masie cząsteczkowej |
279.1181 |
InChI |
InChI=1/C14H8Cl2O2/c15-13(17)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(16)18/h1-8H |
Nr CAS |
2351-37-3 |
EINECS |
219-085-2 |
Struktury molekularnej |
|
Gęstość |
1.344g/cm3 |
Temperatura topnienia |
184℃ |
Temperatura wrzenia |
407.8°C at 760 mmHg |
Współczynnik załamania |
1.603 |
Temperatura zapłonu |
224.1°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|