ChemNet > CAS > 23585-00-4 1-methyl-1H-imidazole-5-carbohydrazide
23585-00-4 1-methyl-1H-imidazole-5-carbohydrazide
Nazwa produktu: |
1-methyl-1H-imidazole-5-carbohydrazide |
MF |
C5H8N4O |
Masie cząsteczkowej |
140.1432 |
InChI |
InChI=1/C5H8N4O/c1-9-3-7-2-4(9)5(10)8-6/h2-3H,6H2,1H3,(H,8,10) |
Nr CAS |
23585-00-4 |
Struktury molekularnej |
|
Gęstość |
1.43g/cm3 |
Temperatura topnienia |
186℃ |
Współczynnik załamania |
1.65 |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|