ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
Nazwa produktu: |
Bis-(4-chlorophenylthio)methane |
Synonimy |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
MF |
C13H10Cl2S2 |
Masie cząsteczkowej |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
Nr CAS |
2393-97-7 |
Struktury molekularnej |
|
Gęstość |
1.38g/cm3 |
Temperatura topnienia |
45-48℃ |
Temperatura wrzenia |
420.9°C at 760 mmHg |
Współczynnik załamania |
1.677 |
Temperatura zapłonu |
192.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|