ChemNet > CAS > 24864-19-5 4-(4-Biphenylyl)-2-methylthiazole
24864-19-5 4-(4-Biphenylyl)-2-methylthiazole
Nazwa produktu: |
4-(4-Biphenylyl)-2-methylthiazole |
Synonimy |
4-(4-Biphenylyl)-2-methyl-1,3-thiazole; 4-(biphenyl-4-yl)-2-methyl-1,3-thiazole |
MF |
C16H13NS |
Masie cząsteczkowej |
251.3461 |
InChI |
InChI=1/C16H13NS/c1-12-17-16(11-18-12)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-11H,1H3 |
Nr CAS |
24864-19-5 |
EINECS |
246-505-1 |
Struktury molekularnej |
|
Gęstość |
1.147g/cm3 |
Temperatura topnienia |
113-118℃ |
Temperatura wrzenia |
431.3°C at 760 mmHg |
Współczynnik załamania |
1.618 |
Temperatura zapłonu |
218.3°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|