ChemNet > CAS > 24932-48-7 4,5-Dibromo-o-xylene
24932-48-7 4,5-Dibromo-o-xylene
Nazwa produktu: |
4,5-Dibromo-o-xylene |
Synonimy |
1,2-Dibromo-4,5-dimethylbenzene |
MF |
C8H8Br2 |
Masie cząsteczkowej |
263.9571 |
InChI |
InChI=1/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
Nr CAS |
24932-48-7 |
Struktury molekularnej |
|
Gęstość |
1.71g/cm3 |
Temperatura wrzenia |
279.1°C at 760 mmHg |
Współczynnik załamania |
1.578 |
Temperatura zapłonu |
138.7°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|