ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
| Nazwa produktu: |
4-Cyano-4-phenylcyclohexanone |
| Synonimy |
4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
| MF |
C13H13NO |
| Masie cząsteczkowej |
199.2484 |
| InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
| Nr CAS |
25115-74-6 |
| EINECS |
246-631-7 |
| Struktury molekularnej |
|
| Gęstość |
1.12g/cm3 |
| Temperatura topnienia |
114-119℃ |
| Temperatura wrzenia |
378.6°C at 760 mmHg |
| Współczynnik załamania |
1.557 |
| Temperatura zapłonu |
182.8°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
