ChemNet > CAS > 25870-62-6 1-Phenyl-2-hexanone
25870-62-6 1-Phenyl-2-hexanone
Nazwa produktu: |
1-Phenyl-2-hexanone |
Synonimy |
Benzyl n-butyl ketone; 1-phenylhexan-2-one |
MF |
C12H16O |
Masie cząsteczkowej |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-9-12(13)10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3 |
Nr CAS |
25870-62-6 |
EINECS |
247-306-2 |
Struktury molekularnej |
|
Gęstość |
0.95g/cm3 |
Temperatura wrzenia |
258°C at 760 mmHg |
Współczynnik załamania |
1.498 |
Temperatura zapłonu |
104.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|