ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
| Nazwa produktu: |
6-Aminochrysene |
| Synonimy |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| MF |
C18H13N |
| Masie cząsteczkowej |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| Nr CAS |
2642-98-0 |
| EINECS |
220-149-7 |
| Struktury molekularnej |
|
| Gęstość |
1.253g/cm3 |
| Temperatura topnienia |
206-211℃ |
| Temperatura wrzenia |
501.2°C at 760 mmHg |
| Współczynnik załamania |
1.813 |
| Temperatura zapłonu |
286.9°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
