ChemNet > CAS > 26586-55-0 4-(4-Methylpiperazino)acetophenone
26586-55-0 4-(4-Methylpiperazino)acetophenone
Nazwa produktu: |
4-(4-Methylpiperazino)acetophenone |
Synonimy |
Acetophenone, 4'-(4-methyl-1-piperazinyl)-; 5-23-02-00200 (Beilstein Handbook Reference); BRN 0885205; NSC 102840; p-(4-Methylpiperazino)-acetophenone; 1-(4-(4-Methylpiperazin-1-yl)phenyl)ethan-1-one; Ethanone, 1-(4-(4-methyl-1-piperazinyl)phenyl)- (9CI); 1-[4-(4-methylpiperazin-1-yl)phenyl]ethanone; 4-(4-acetylphenyl)-1-methylpiperazin-1-ium |
MF |
C13H19N2O |
Masie cząsteczkowej |
219.3022 |
InChI |
InChI=1/C13H18N2O/c1-11(16)12-3-5-13(6-4-12)15-9-7-14(2)8-10-15/h3-6H,7-10H2,1-2H3/p+1 |
Nr CAS |
26586-55-0 |
EINECS |
247-827-5 |
Struktury molekularnej |
|
Temperatura topnienia |
96-100℃ |
Temperatura wrzenia |
365.1°C at 760 mmHg |
Temperatura zapłonu |
159.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|