ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
Nazwa produktu: |
2,5-Dimethyl-1,3,4-thiadiazole |
Synonimy |
1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
MF |
C4H6N2S |
Masie cząsteczkowej |
114.1688 |
InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
Nr CAS |
27464-82-0 |
EINECS |
248-473-4 |
Struktury molekularnej |
|
Gęstość |
1.166g/cm3 |
Temperatura topnienia |
62-65℃ |
Temperatura wrzenia |
202.5°C at 760 mmHg |
Współczynnik załamania |
1.534 |
Temperatura zapłonu |
81.2°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|