ChemNet > CAS > 28469-92-3 2,6-Dichlorostyrene
28469-92-3 2,6-Dichlorostyrene
Nazwa produktu: |
2,6-Dichlorostyrene |
Synonimy |
Benzene, 1,3-dichloro-2-ethenyl-; 1,3-dichloro-2-ethenylbenzene |
MF |
C8H6Cl2 |
Masie cząsteczkowej |
173.0392 |
InChI |
InChI=1/C8H6Cl2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 |
Nr CAS |
28469-92-3 |
EINECS |
249-039-7 |
Struktury molekularnej |
|
Gęstość |
1.242g/cm3 |
Temperatura wrzenia |
222.4°C at 760 mmHg |
Współczynnik załamania |
1.589 |
Temperatura zapłonu |
93.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|