ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
Nazwa produktu: |
Dimethyl phenylphosphonite |
Synonimy |
Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
MF |
C8H11O2P |
Masie cząsteczkowej |
170.1455 |
InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
Nr CAS |
2946-61-4 |
EINECS |
220-960-6 |
Struktury molekularnej |
|
Temperatura wrzenia |
194.1°C at 760 mmHg |
Temperatura zapłonu |
81°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|