ChemNet > CAS > 325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
| Nazwa produktu: |
5-Fluoro-2-methylphenylhydrazine hydrochloride |
| Synonimy |
(5-fluoro-2-methylphenyl)diazanium chloride; (5-fluoro-2-methylphenyl)hydrazine |
| MF |
C7H9FN2 |
| Masie cząsteczkowej |
140.1582 |
| InChI |
InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
| Nr CAS |
325-50-8 |
| Struktury molekularnej |
|
| Gęstość |
1.202g/cm3 |
| Temperatura wrzenia |
212°C at 760 mmHg |
| Współczynnik załamania |
1.594 |
| Temperatura zapłonu |
82°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
