ChemNet > CAS > 32690-28-1 4,5-Dinitro-o-phenylenediamine
32690-28-1 4,5-Dinitro-o-phenylenediamine
| Nazwa produktu: |
4,5-Dinitro-o-phenylenediamine |
| Synonimy |
4,5-Dinitro-1,2-diaminobenzene; 4,5-dinitrobenzene-1,2-diamine |
| MF |
C6H6N4O4 |
| Masie cząsteczkowej |
198.1362 |
| InChI |
InChI=1/C6H6N4O4/c7-3-1-5(9(11)12)6(10(13)14)2-4(3)8/h1-2H,7-8H2 |
| Nr CAS |
32690-28-1 |
| Struktury molekularnej |
|
| Gęstość |
1.683g/cm3 |
| Temperatura topnienia |
213℃ |
| Temperatura wrzenia |
541.1°C at 760 mmHg |
| Współczynnik załamania |
1.747 |
| Temperatura zapłonu |
281°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
