ChemNet > CAS > 33685-54-0 1,1,2,2-Tetrachloroethane-d2
33685-54-0 1,1,2,2-Tetrachloroethane-d2
| Nazwa produktu: |
1,1,2,2-Tetrachloroethane-d2 |
| Synonimy |
1,1,2,2-Tetrachloro-(1,2-2H2)ethane; Ethane-1,2-d2, 1,1,2,2-tetrachloro-; 1,1,2,2-tetrachloro(~2~H_2_)ethane |
| MF |
C2D2Cl4 |
| Masie cząsteczkowej |
169.8616 |
| InChI |
InChI=1/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D |
| Nr CAS |
33685-54-0 |
| EINECS |
251-634-1 |
| Struktury molekularnej |
|
| Gęstość |
1.575g/cm3 |
| Temperatura wrzenia |
142°C at 760 mmHg |
| Współczynnik załamania |
1.479 |
| Temperatura zapłonu |
42.6°C |
| Symbole zagrożenia |
 T+:Very toxic;
 N:Dangerous for the environment;
|
| Kody ryzyka |
R26/27:Very toxic by inhalation and in contact with skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpieczeństwo opis |
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
