ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
| Nazwa produktu: |
1-Ethyl-3-methyl-4-piperidone |
| Synonimy |
1-ethyl-3-methylpiperidin-4-one |
| MF |
C8H15NO |
| Masie cząsteczkowej |
141.2108 |
| InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
| Nr CAS |
3612-16-6 |
| Struktury molekularnej |
|
| Gęstość |
0.931g/cm3 |
| Temperatura wrzenia |
212.3°C at 760 mmHg |
| Współczynnik załamania |
1.45 |
| Temperatura zapłonu |
76.2°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
