ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
Nazwa produktu: |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
Synonimy |
1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
MF |
C14H17NO |
Masie cząsteczkowej |
215.2909 |
InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
Nr CAS |
36263-51-1 |
EINECS |
252-938-7 |
Struktury molekularnej |
|
Gęstość |
1.06g/cm3 |
Temperatura topnienia |
40-45℃ |
Temperatura wrzenia |
362°C at 760 mmHg |
Współczynnik załamania |
1.538 |
Temperatura zapłonu |
152.6°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|