ChemNet > CAS > 368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
| Nazwa produktu: |
4-(1H-pyrazol-1-yl)benzylamine |
| Synonimy |
1-[4-(1H-pyrazol-1-yl)phenyl]methanamine; 4-(Pyrazol-1-yl)benzylamine |
| MF |
C10H11N3 |
| Masie cząsteczkowej |
173.2144 |
| InChI |
InChI=1/C10H11N3/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8,11H2 |
| Nr CAS |
368870-03-5 |
| Struktury molekularnej |
|
| Gęstość |
1.16g/cm3 |
| Temperatura topnienia |
94℃ |
| Temperatura wrzenia |
307.1°C at 760 mmHg |
| Współczynnik załamania |
1.622 |
| Temperatura zapłonu |
139.6°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
