ChemNet > CAS > 394-35-4 methyl 2-fluorobenzoate
394-35-4 methyl 2-fluorobenzoate
Nazwa produktu: |
methyl 2-fluorobenzoate |
Synonimy |
2-Fluorobenzoic acid methyl ester |
MF |
C8H7FO2 |
Masie cząsteczkowej |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
Nr CAS |
394-35-4 |
EINECS |
206-894-0 |
Struktury molekularnej |
|
Gęstość |
1.21 |
Temperatura wrzenia |
99℃ (18 torr) |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|