ChemNet > CAS > 3988-03-2 4,4'-dibromobenzophenone
3988-03-2 4,4'-dibromobenzophenone
Nazwa produktu: |
4,4'-dibromobenzophenone |
Synonimy |
Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
MF |
C13H8Br2O |
Masie cząsteczkowej |
340.01 |
InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
Nr CAS |
3988-03-2 |
EINECS |
223-632-0 |
Struktury molekularnej |
|
Gęstość |
1.7g/cm3 |
Temperatura topnienia |
171-174℃ |
Temperatura wrzenia |
395.6°C at 760 mmHg |
Współczynnik załamania |
1.633 |
Temperatura zapłonu |
121°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S22:;
S24/25:;
|
|