ChemNet > CAS > 40763-96-0 5-Chloro-2-nitrobenzamide
40763-96-0 5-Chloro-2-nitrobenzamide
Nazwa produktu: |
5-Chloro-2-nitrobenzamide |
MF |
C7H5ClN2O3 |
Masie cząsteczkowej |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
Nr CAS |
40763-96-0 |
Struktury molekularnej |
|
Gęstość |
1.52g/cm3 |
Temperatura topnienia |
157-160℃ |
Temperatura wrzenia |
301.7°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
136.3°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|