ChemNet > CAS > 41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
| Nazwa produktu: |
1-Bromo-4-chloro-2-nitrobenzene |
| Synonimy |
2-Bromo-5-chloronitrobenzene |
| MF |
C6H3BrClNO2 |
| Masie cząsteczkowej |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| Nr CAS |
41513-04-6 |
| EINECS |
255-421-4 |
| Struktury molekularnej |
|
| Gęstość |
1.827g/cm3 |
| Temperatura topnienia |
67-70℃ |
| Temperatura wrzenia |
242.5°C at 760 mmHg |
| Współczynnik załamania |
1.618 |
| Temperatura zapłonu |
100.5°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
