ChemNet > CAS > 4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
4491-92-3 1-(2-Cyanoethyl)-4-methylpiperazine
Nazwa produktu: |
1-(2-Cyanoethyl)-4-methylpiperazine |
Synonimy |
3-(4-Methylpiperazino)propionitrile; 3-(4-methylpiperazin-1-yl)propanenitrile |
MF |
C8H15N3 |
Masie cząsteczkowej |
153.2248 |
InChI |
InChI=1/C8H15N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2,4-8H2,1H3 |
Nr CAS |
4491-92-3 |
Struktury molekularnej |
|
Gęstość |
0.981g/cm3 |
Temperatura wrzenia |
273°C at 760 mmHg |
Współczynnik załamania |
1.477 |
Temperatura zapłonu |
113.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|