ChemNet > CAS > 455-37-8 3-fluorobenzamide
455-37-8 3-fluorobenzamide
Nazwa produktu: |
3-fluorobenzamide |
Synonimy |
m-Fluorobenzamide |
MF |
C7H6FNO |
Masie cząsteczkowej |
139.127 |
InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
Nr CAS |
455-37-8 |
EINECS |
207-247-5 |
Struktury molekularnej |
|
Gęstość |
1.238g/cm3 |
Temperatura topnienia |
129-132℃ |
Temperatura wrzenia |
238.4°C at 760 mmHg |
Współczynnik załamania |
1.538 |
Temperatura zapłonu |
98°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|