ChemNet > CAS > 459-47-2 1,4-ethylfluorobenzene
459-47-2 1,4-ethylfluorobenzene
Nazwa produktu: |
1,4-ethylfluorobenzene |
Synonimy |
1-Ethyl-4-fluorobenzene; benzene, 1-ethyl-4-fluoro-; Ethyl-4-fluorobenzene |
MF |
C8H9F |
Masie cząsteczkowej |
124.1555 |
InChI |
InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
Nr CAS |
459-47-2 |
Struktury molekularnej |
|
Gęstość |
0.981g/cm3 |
Temperatura wrzenia |
141.6°C at 760 mmHg |
Współczynnik załamania |
1.477 |
Temperatura zapłonu |
28.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
R10:Flammable.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|