ChemNet > CAS > 50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
| Nazwa produktu: |
(2,4-dimethyl-1,3-thiazol-5-yl)methanol |
| Synonimy |
(2,4-dimethylthiazol-5-yl)methanol;
|
| MF |
C6H9NOS |
| Masie cząsteczkowej |
143.2068 |
| InChI |
InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
| Nr CAS |
50382-32-6 |
| Struktury molekularnej |
|
| Gęstość |
1.208g/cm3 |
| Temperatura topnienia |
46℃ |
| Temperatura wrzenia |
261.965°C at 760 mmHg |
| Współczynnik załamania |
1.569 |
| Temperatura zapłonu |
112.233°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
