ChemNet > CAS > 5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
Nazwa produktu: |
2-amino-4,5-dimethyl-3-furancarbonitrile |
Synonimy |
2-Amino-4,5-dimethyl-3-furonitrile; 2-amino-4,5-dimethylfuran-3-carbonitrile |
MF |
C7H8N2O |
Masie cząsteczkowej |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-4-5(2)10-7(9)6(4)3-8/h9H2,1-2H3 |
Nr CAS |
5117-88-4 |
Struktury molekularnej |
|
Gęstość |
1.15g/cm3 |
Temperatura topnienia |
163-169℃ |
Temperatura wrzenia |
287.8°C at 760 mmHg |
Współczynnik załamania |
1.535 |
Temperatura zapłonu |
127.8°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|