ChemNet > CAS > 51660-08-3 5-chloro-6-phenylpyridazin-3-ol
51660-08-3 5-chloro-6-phenylpyridazin-3-ol
Nazwa produktu: |
5-chloro-6-phenylpyridazin-3-ol |
Synonimy |
5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
MF |
C10H7ClN2O |
Masie cząsteczkowej |
206.6284 |
InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
Nr CAS |
51660-08-3 |
Struktury molekularnej |
|
Gęstość |
1.35g/cm3 |
Temperatura topnienia |
235℃ |
Temperatura wrzenia |
403.2°C at 760 mmHg |
Współczynnik załamania |
1.641 |
Temperatura zapłonu |
197.7°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|