ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
Nazwa produktu: |
Diphenylborinic acid 2-aminoethyl ester |
Synonimy |
2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
MF |
C14H16BNO |
Masie cząsteczkowej |
225.0939 |
InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
Nr CAS |
524-95-8 |
EINECS |
208-366-5 |
Struktury molekularnej |
|
Gęstość |
1.04g/cm3 |
Temperatura topnienia |
190-194℃ |
Temperatura wrzenia |
325.3°C at 760 mmHg |
Współczynnik załamania |
1.559 |
Temperatura zapłonu |
150.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|