ChemNet > CAS > 53-96-3 2-Acetamidofluorene
53-96-3 2-Acetamidofluorene
| Nazwa produktu: |
2-Acetamidofluorene |
| Synonimy |
N-(2-Fluorenyl)acetamide; Acetamidofluorene; N-(9H-fluoren-2-yl)acetamide; 2-(9H-fluoren-2-yl)acetamide |
| MF |
C15H13NO |
| Masie cząsteczkowej |
223.2698 |
| InChI |
InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
| Nr CAS |
53-96-3 |
| EINECS |
200-188-6 |
| Struktury molekularnej |
|
| Gęstość |
1.227g/cm3 |
| Temperatura topnienia |
192-196℃ |
| Temperatura wrzenia |
471.2°C at 760 mmHg |
| Współczynnik załamania |
1.656 |
| Temperatura zapłonu |
238.8°C |
| Rozpuszczalność w wodzie |
0.000529 g/100 mL |
| Symbole zagrożenia |
 T:Toxic;
|
| Kody ryzyka |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R46:May cause heritable genetic damages.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
