ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| Nazwa produktu: |
3-Methylthiophene-2-carbonitrile |
| Synonimy |
2-Cyano-3-methylthiophene |
| MF |
C6H5NS |
| Masie cząsteczkowej |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| Nr CAS |
55406-13-8 |
| Struktury molekularnej |
|
| Gęstość |
1.16g/cm3 |
| Temperatura wrzenia |
212.7°C at 760 mmHg |
| Współczynnik załamania |
1.556 |
| Temperatura zapłonu |
82.4°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
