ChemNet > CAS > 55752-58-4 2,3-Dimethylphenylthiourea
55752-58-4 2,3-Dimethylphenylthiourea
Nazwa produktu: |
2,3-Dimethylphenylthiourea |
Synonimy |
1-(2,3-dimethylphenyl)thiourea |
MF |
C9H12N2S |
Masie cząsteczkowej |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-8(7(6)2)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
Nr CAS |
55752-58-4 |
Struktury molekularnej |
|
Gęstość |
1.2g/cm3 |
Temperatura wrzenia |
294.3°C at 760 mmHg |
Współczynnik załamania |
1.674 |
Temperatura zapłonu |
131.8°C |
Symbole zagrożenia |
|
Kody ryzyka |
R25:Toxic if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|