ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
| Nazwa produktu: |
2,3-Dichloroacetophenone |
| Synonimy |
1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
| MF |
C8H6Cl2O |
| Masie cząsteczkowej |
189.0386 |
| InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| Nr CAS |
56041-57-7 |
| EINECS |
259-954-3 |
| Struktury molekularnej |
|
| Gęstość |
1.304g/cm3 |
| Temperatura topnienia |
106℃ |
| Temperatura wrzenia |
247.3°C at 760 mmHg |
| Współczynnik załamania |
1.548 |
| Temperatura zapłonu |
101.3°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
