ChemNet > CAS > 57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
Nazwa produktu: |
2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
Synonimy |
2,5-Dimethylpyrrole-3-carboxylic acid; 2,5-dimethyl-1H-pyrrole-3-carboxylate |
MF |
C7H8NO2 |
Masie cząsteczkowej |
138.1445 |
InChI |
InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
Nr CAS |
57338-76-8 |
Struktury molekularnej |
|
Temperatura topnienia |
200℃ |
Temperatura wrzenia |
318.4°C at 760 mmHg |
Temperatura zapłonu |
146.4°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|