ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
| Nazwa produktu: |
4-Methylcyclohexanol, mixture of cis and trans |
| Synonimy |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
| MF |
C7H14O |
| Masie cząsteczkowej |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
| Nr CAS |
589-91-3 |
| EINECS |
209-664-8 |
| Struktury molekularnej |
|
| Gęstość |
0.925g/cm3 |
| Temperatura topnienia |
-41℃ |
| Temperatura wrzenia |
170.322°C at 760 mmHg |
| Współczynnik załamania |
1.463 |
| Temperatura zapłonu |
70°C |
| Rozpuszczalność w wodzie |
slightly soluble |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:;
|
|
