ChemNet > CAS > 61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
61226-19-5 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid
| Nazwa produktu: |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
| Synonimy |
3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylate |
| MF |
C12H11N2O2 |
| Masie cząsteczkowej |
215.2285 |
| InChI |
InChI=1/C12H12N2O2/c1-8-11(12(15)16)9(2)14(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16)/p-1 |
| Nr CAS |
61226-19-5 |
| Struktury molekularnej |
|
| Temperatura topnienia |
202℃ |
| Temperatura wrzenia |
387.7°C at 760 mmHg |
| Temperatura zapłonu |
188.2°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
