ChemNet > CAS > 623-51-8 Ethyl 2-mercaptoacetate
623-51-8 Ethyl 2-mercaptoacetate
| Nazwa produktu: |
Ethyl 2-mercaptoacetate |
| Synonimy |
Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
| MF |
C4H8O2S |
| Masie cząsteczkowej |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
| Nr CAS |
623-51-8 |
| EINECS |
210-800-3 |
| Struktury molekularnej |
|
| Gęstość |
1.072g/cm3 |
| Temperatura wrzenia |
157.8°C at 760 mmHg |
| Współczynnik załamania |
1.452 |
| Temperatura zapłonu |
47.8°C |
| Symbole zagrożenia |
 T:Toxic;
|
| Kody ryzyka |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
