ChemNet > CAS > 6282-00-4 NN-Dipropylformamide
6282-00-4 NN-Dipropylformamide
| Nazwa produktu: |
NN-Dipropylformamide |
| Synonimy |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
| MF |
C7H15NO |
| Masie cząsteczkowej |
129.2001 |
| InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
| Nr CAS |
6282-00-4 |
| Struktury molekularnej |
|
| Gęstość |
0.869g/cm3 |
| Temperatura wrzenia |
221.3°C at 760 mmHg |
| Współczynnik załamania |
1.429 |
| Temperatura zapłonu |
83.7°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
