ChemNet > CAS > 63155-04-4 4-chloro-5-methylbenzene-1,2-diamine
63155-04-4 4-chloro-5-methylbenzene-1,2-diamine
| Nazwa produktu: |
4-chloro-5-methylbenzene-1,2-diamine |
| Synonimy |
1,2-Diamino-4-chloro-5-methylbenzene |
| MF |
C7H9ClN2 |
| Masie cząsteczkowej |
156.6128 |
| InChI |
InChI=1/C7H9ClN2/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,9-10H2,1H3 |
| Nr CAS |
63155-04-4 |
| Struktury molekularnej |
|
| Gęstość |
1.281g/cm3 |
| Temperatura topnienia |
138℃ |
| Temperatura wrzenia |
307°C at 760 mmHg |
| Współczynnik załamania |
1.647 |
| Temperatura zapłonu |
139.4°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
