ChemNet > CAS > 6320-15-6 6-Chloro-2,4-dimethixypyrimidine
6320-15-6 6-Chloro-2,4-dimethixypyrimidine
Nazwa produktu: |
6-Chloro-2,4-dimethixypyrimidine |
Synonimy |
6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
MF |
C6H7ClN2O2 |
Masie cząsteczkowej |
174.585 |
InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
Nr CAS |
6320-15-6 |
EINECS |
228-669-6 |
Struktury molekularnej |
|
Gęstość |
1.285g/cm3 |
Temperatura topnienia |
74-76℃ |
Temperatura wrzenia |
280.6°C at 760 mmHg |
Współczynnik załamania |
1.51 |
Temperatura zapłonu |
123.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|