ChemNet > CAS > 6484-25-9 4-Chloro-2-phenylquinazoline
6484-25-9 4-Chloro-2-phenylquinazoline
Nazwa produktu: |
4-Chloro-2-phenylquinazoline |
Synonimy |
AM-ex-OL |
MF |
C14H9ClN2 |
Masie cząsteczkowej |
240.6877 |
InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
Nr CAS |
6484-25-9 |
EINECS |
229-346-2 |
Struktury molekularnej |
|
Gęstość |
1.285g/cm3 |
Temperatura topnienia |
123-128℃ |
Temperatura wrzenia |
301.2°C at 760 mmHg |
Współczynnik załamania |
1.667 |
Temperatura zapłonu |
164.4°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|