ChemNet > CAS > 65369-29-1 4-methoxythiophene-3-carboxamide
65369-29-1 4-methoxythiophene-3-carboxamide
Nazwa produktu: |
4-methoxythiophene-3-carboxamide |
MF |
C6H7NO2S |
Masie cząsteczkowej |
157.1903 |
InChI |
InChI=1/C6H7NO2S/c1-9-5-3-10-2-4(5)6(7)8/h2-3H,1H3,(H2,7,8) |
Nr CAS |
65369-29-1 |
Struktury molekularnej |
|
Gęstość |
1.292g/cm3 |
Temperatura topnienia |
118℃ |
Temperatura wrzenia |
304.9°C at 760 mmHg |
Współczynnik załamania |
1.576 |
Temperatura zapłonu |
138.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|